About 3-chloro-1,1-dimethoxybutane
3-chloro-1,1-dimethoxybutane (PubChem CID 119097582) has the molecular formula C6H13ClO2
and a molecular weight of 152.62 g/mol. Its IUPAC name is 3-chloro-1,1-dimethoxybutane.
Molecular Properties
| Compound Name | 3-chloro-1,1-dimethoxybutane |
| PubChem CID | 119097582 |
| Molecular Formula | C6H13ClO2 |
| Molecular Weight | 152.62 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 3-chloro-1,1-dimethoxybutane |
| SMILES | COC(CC(C)Cl)OC |
| InChI | InChI=1S/C6H13ClO2/c1-5(7)4-6(8-2)9-3/h5-6H,4H2,1-3H3 |
| InChIKey | MMNPBFMNTHGEPH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.62 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1,1-dimethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,1-dimethoxybutane?
The IUPAC name of 3-chloro-1,1-dimethoxybutane (CID 119097582) is 3-chloro-1,1-dimethoxybutane.
What is the SMILES notation for 3-chloro-1,1-dimethoxybutane?
The canonical SMILES for 3-chloro-1,1-dimethoxybutane is COC(CC(C)Cl)OC.
What is the InChIKey of 3-chloro-1,1-dimethoxybutane?
The InChIKey is MMNPBFMNTHGEPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13ClO2/c1-5(7)4-6(8-2)9-3/h5-6H,4H2,1-3H3.
What are the key properties of 3-chloro-1,1-dimethoxybutane?
3-chloro-1,1-dimethoxybutane has a molecular weight of 152.62 g/mol, XLogP of 1.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,1-dimethoxybutane is sourced from PubChem (CID 119097582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).