About 2-aminosilyl-1,1-dimethoxyethane
2-aminosilyl-1,1-dimethoxyethane (PubChem CID 150753930) has the molecular formula C4H13NO2Si
and a molecular weight of 135.24 g/mol. Its IUPAC name is 2-aminosilyl-1,1-dimethoxyethane.
Molecular Properties
| Compound Name | 2-aminosilyl-1,1-dimethoxyethane |
| PubChem CID | 150753930 |
| Molecular Formula | C4H13NO2Si |
| Molecular Weight | 135.24 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-aminosilyl-1,1-dimethoxyethane |
| SMILES | COC(C[SiH2]N)OC |
| InChI | InChI=1S/C4H13NO2Si/c1-6-4(7-2)3-8-5/h4H,3,5,8H2,1-2H3 |
| InChIKey | JWLKLRVRFFFDEE-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.24 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-aminosilyl-1,1-dimethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminosilyl-1,1-dimethoxyethane?
The IUPAC name of 2-aminosilyl-1,1-dimethoxyethane (CID 150753930) is 2-aminosilyl-1,1-dimethoxyethane.
What is the SMILES notation for 2-aminosilyl-1,1-dimethoxyethane?
The canonical SMILES for 2-aminosilyl-1,1-dimethoxyethane is COC(C[SiH2]N)OC.
What is the InChIKey of 2-aminosilyl-1,1-dimethoxyethane?
The InChIKey is JWLKLRVRFFFDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13NO2Si/c1-6-4(7-2)3-8-5/h4H,3,5,8H2,1-2H3.
What are the key properties of 2-aminosilyl-1,1-dimethoxyethane?
2-aminosilyl-1,1-dimethoxyethane has a molecular weight of 135.24 g/mol, XLogP of -0.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminosilyl-1,1-dimethoxyethane is sourced from PubChem (CID 150753930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).