C4H13NO2Si — CID 150753930
2-aminosilyl-1,1-dimethoxyethane (PubChem CID 150753930) has the molecular formula C4H13NO2Si and a molecular weight of 135.24 g/mol. Its IUPAC name is 2-aminosilyl-1,1-dimethoxyethane.
| Compound Name | 2-aminosilyl-1,1-dimethoxyethane |
|---|---|
| PubChem CID | 150753930 |
| Molecular Formula | C4H13NO2Si |
| Molecular Weight | 135.24 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-aminosilyl-1,1-dimethoxyethane |
| SMILES | COC(C[SiH2]N)OC |
| InChI | InChI=1S/C4H13NO2Si/c1-6-4(7-2)3-8-5/h4H,3,5,8H2,1-2H3 |
| InChIKey | JWLKLRVRFFFDEE-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.24 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|