C8H20O6 — CID 131726685
2-(2,2-dimethoxyethoxy)-1,1-dimethoxyethane;hydrate (PubChem CID 131726685) has the molecular formula C8H20O6 and a molecular weight of 212.24 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethoxy)-1,1-dimethoxyethane;hydrate.
| Compound Name | 2-(2,2-dimethoxyethoxy)-1,1-dimethoxyethane;hydrate |
|---|---|
| PubChem CID | 131726685 |
| Molecular Formula | C8H20O6 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-(2,2-dimethoxyethoxy)-1,1-dimethoxyethane;hydrate |
| SMILES | COC(COCC(OC)OC)OC.O |
| InChI | InChI=1S/C8H18O5.H2O/c1-9-7(10-2)5-13-6-8(11-3)12-4;/h7-8H,5-6H2,1-4H3;1H2 |
| InChIKey | TVNGQOZULHELNT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 77.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|