C10H23NO3 — CID 115486739
3-(2,2-dimethoxyethoxy)-N-propan-2-ylpropan-1-amine (PubChem CID 115486739) has the molecular formula C10H23NO3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethoxy)-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-(2,2-dimethoxyethoxy)-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 115486739 |
| Molecular Formula | C10H23NO3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 3-(2,2-dimethoxyethoxy)-N-propan-2-ylpropan-1-amine |
| SMILES | COC(COCCCNC(C)C)OC |
| InChI | InChI=1S/C10H23NO3/c1-9(2)11-6-5-7-14-8-10(12-3)13-4/h9-11H,5-8H2,1-4H3 |
| InChIKey | VBAWBLVJVZOPTP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|