C11H24O6 — CID 14433926
1,1-dimethoxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethane (PubChem CID 14433926) has the molecular formula C11H24O6 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1,1-dimethoxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethane.
| Compound Name | 1,1-dimethoxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethane |
|---|---|
| PubChem CID | 14433926 |
| Molecular Formula | C11H24O6 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1,1-dimethoxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethane |
| SMILES | COCCOCCOCCOCC(OC)OC |
| InChI | InChI=1S/C11H24O6/c1-12-4-5-15-6-7-16-8-9-17-10-11(13-2)14-3/h11H,4-10H2,1-3H3 |
| InChIKey | JDNONQJRQTWIKB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|