C13H28O8 — CID 87208063
2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethane-1,1-diol (PubChem CID 87208063) has the molecular formula C13H28O8 and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethane-1,1-diol.
| Compound Name | 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethane-1,1-diol |
|---|---|
| PubChem CID | 87208063 |
| Molecular Formula | C13H28O8 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethane-1,1-diol |
| SMILES | COCCOCCOCCOCCOCCOCC(O)O |
| InChI | InChI=1S/C13H28O8/c1-16-2-3-17-4-5-18-6-7-19-8-9-20-10-11-21-12-13(14)15/h13-15H,2-12H2,1H3 |
| InChIKey | UCCPDPISFYNAEE-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|