About 2,2-dimethoxyethyl 2-methylpropanoate
2,2-dimethoxyethyl 2-methylpropanoate (PubChem CID 86008683) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is 2,2-dimethoxyethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2,2-dimethoxyethyl 2-methylpropanoate |
| PubChem CID | 86008683 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2,2-dimethoxyethyl 2-methylpropanoate |
| SMILES | COC(COC(=O)C(C)C)OC |
| InChI | InChI=1S/C8H16O4/c1-6(2)8(9)12-5-7(10-3)11-4/h6-7H,5H2,1-4H3 |
| InChIKey | FWFMFNPBESPWBT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxyethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxyethyl 2-methylpropanoate?
The IUPAC name of 2,2-dimethoxyethyl 2-methylpropanoate (CID 86008683) is 2,2-dimethoxyethyl 2-methylpropanoate.
What is the SMILES notation for 2,2-dimethoxyethyl 2-methylpropanoate?
The canonical SMILES for 2,2-dimethoxyethyl 2-methylpropanoate is COC(COC(=O)C(C)C)OC.
What is the InChIKey of 2,2-dimethoxyethyl 2-methylpropanoate?
The InChIKey is FWFMFNPBESPWBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4/c1-6(2)8(9)12-5-7(10-3)11-4/h6-7H,5H2,1-4H3.
What are the key properties of 2,2-dimethoxyethyl 2-methylpropanoate?
2,2-dimethoxyethyl 2-methylpropanoate has a molecular weight of 176.21 g/mol, XLogP of 0.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxyethyl 2-methylpropanoate is sourced from PubChem (CID 86008683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).