C13H24O8 — CID 88691343
bis(2,2-dimethoxyethyl) pentanedioate (PubChem CID 88691343) has the molecular formula C13H24O8 and a molecular weight of 308.33 g/mol. Its IUPAC name is bis(2,2-dimethoxyethyl) pentanedioate.
| Compound Name | bis(2,2-dimethoxyethyl) pentanedioate |
|---|---|
| PubChem CID | 88691343 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | bis(2,2-dimethoxyethyl) pentanedioate |
| SMILES | COC(COC(=O)CCCC(=O)OCC(OC)OC)OC |
| InChI | InChI=1S/C13H24O8/c1-16-12(17-2)8-20-10(14)6-5-7-11(15)21-9-13(18-3)19-4/h12-13H,5-9H2,1-4H3 |
| InChIKey | HKHDCZLXBQSUIM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|