C12H22O7 — CID 130455562
5-[(2S)-2-(1-hydroxybutan-2-yloxy)-2-methoxyethoxy]-5-oxopentanoic acid (PubChem CID 130455562) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-[(2S)-2-(1-hydroxybutan-2-yloxy)-2-methoxyethoxy]-5-oxopentanoic acid.
| Compound Name | 5-[(2S)-2-(1-hydroxybutan-2-yloxy)-2-methoxyethoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 130455562 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-[(2S)-2-(1-hydroxybutan-2-yloxy)-2-methoxyethoxy]-5-oxopentanoic acid |
| SMILES | CCC(CO)O[C@@H](COC(=O)CCCC(=O)O)OC |
| InChI | InChI=1S/C12H22O7/c1-3-9(7-13)19-12(17-2)8-18-11(16)6-4-5-10(14)15/h9,12-13H,3-8H2,1-2H3,(H,14,15)/t9?,12-/m0/s1 |
| InChIKey | KHFUDJZPYMGTLW-ACGXKRRESA-N |
| XLogP | 0.54 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|