C12H23NO6 — CID 90360417
[2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] N-(3-oxobutyl)carbamate (PubChem CID 90360417) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] N-(3-oxobutyl)carbamate.
| Compound Name | [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] N-(3-oxobutyl)carbamate |
|---|---|
| PubChem CID | 90360417 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [2-(1-hydroxybutan-2-yloxy)-2-methoxyethyl] N-(3-oxobutyl)carbamate |
| SMILES | CCC(CO)OC(COC(=O)NCCC(C)=O)OC |
| InChI | InChI=1S/C12H23NO6/c1-4-10(7-14)19-11(17-3)8-18-12(16)13-6-5-9(2)15/h10-11,14H,4-8H2,1-3H3,(H,13,16) |
| InChIKey | KIVRLNDPIYEIHB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|