C11H21NO7 — CID 122451526
3-[2-(2-hydroxy-1-methoxyethoxy)butoxycarbonylamino]propanoic acid (PubChem CID 122451526) has the molecular formula C11H21NO7 and a molecular weight of 279.29 g/mol. Its IUPAC name is 3-[2-(2-hydroxy-1-methoxyethoxy)butoxycarbonylamino]propanoic acid.
| Compound Name | 3-[2-(2-hydroxy-1-methoxyethoxy)butoxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 122451526 |
| Molecular Formula | C11H21NO7 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[2-(2-hydroxy-1-methoxyethoxy)butoxycarbonylamino]propanoic acid |
| SMILES | CCC(COC(=O)NCCC(=O)O)OC(CO)OC |
| InChI | InChI=1S/C11H21NO7/c1-3-8(19-10(6-13)17-2)7-18-11(16)12-5-4-9(14)15/h8,10,13H,3-7H2,1-2H3,(H,12,16)(H,14,15) |
| InChIKey | PGPPVAHIDCWURF-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|