C7H13NO6 — CID 155479234
3-(2,3-dihydroxypropoxycarbonylamino)propanoic acid (PubChem CID 155479234) has the molecular formula C7H13NO6 and a molecular weight of 207.18 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxycarbonylamino)propanoic acid.
| Compound Name | 3-(2,3-dihydroxypropoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 155479234 |
| Molecular Formula | C7H13NO6 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3-(2,3-dihydroxypropoxycarbonylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=O)OCC(O)CO |
| InChI | InChI=1S/C7H13NO6/c9-3-5(10)4-14-7(13)8-2-1-6(11)12/h5,9-10H,1-4H2,(H,8,13)(H,11,12) |
| InChIKey | CDJRQNQFTFIIHY-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |