C6H14N2O4 — CID 139478100
2,3-dihydroxypropyl N-(2-aminoethyl)carbamate (PubChem CID 139478100) has the molecular formula C6H14N2O4 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2,3-dihydroxypropyl N-(2-aminoethyl)carbamate.
| Compound Name | 2,3-dihydroxypropyl N-(2-aminoethyl)carbamate |
|---|---|
| PubChem CID | 139478100 |
| Molecular Formula | C6H14N2O4 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2,3-dihydroxypropyl N-(2-aminoethyl)carbamate |
| SMILES | NCCNC(=O)OCC(O)CO |
| InChI | InChI=1S/C6H14N2O4/c7-1-2-8-6(11)12-4-5(10)3-9/h5,9-10H,1-4,7H2,(H,8,11) |
| InChIKey | FFYBGTWZTUYEEO-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |