C11H23NO7 — CID 22886573
methyl N-[2-[2-[2-(2,3-dihydroxypropoxy)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 22886573) has the molecular formula C11H23NO7 and a molecular weight of 281.30 g/mol. Its IUPAC name is methyl N-[2-[2-[2-(2,3-dihydroxypropoxy)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[2-[2-(2,3-dihydroxypropoxy)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 22886573 |
| Molecular Formula | C11H23NO7 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | methyl N-[2-[2-[2-(2,3-dihydroxypropoxy)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | COC(=O)NCCOCCOCCOCC(O)CO |
| InChI | InChI=1S/C11H23NO7/c1-16-11(15)12-2-3-17-4-5-18-6-7-19-9-10(14)8-13/h10,13-14H,2-9H2,1H3,(H,12,15) |
| InChIKey | ZFRDXHDNYKJONM-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|