C13H27NO7 — CID 162683918
propan-2-yl N-[2-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 162683918) has the molecular formula C13H27NO7 and a molecular weight of 309.36 g/mol. Its IUPAC name is propan-2-yl N-[2-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | propan-2-yl N-[2-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 162683918 |
| Molecular Formula | C13H27NO7 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | propan-2-yl N-[2-[2-[2-[2-(hydroxymethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)OC(=O)NCCOCCOCCOCCOCO |
| InChI | InChI=1S/C13H27NO7/c1-12(2)21-13(16)14-3-4-17-5-6-18-7-8-19-9-10-20-11-15/h12,15H,3-11H2,1-2H3,(H,14,16) |
| InChIKey | SLDLKDLIVFDYAX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|