About butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen
butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen (PubChem CID 154661368) has the molecular formula C10H23NO4
and a molecular weight of 221.30 g/mol. Its IUPAC name is butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen.
Molecular Properties
| Compound Name | butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen |
| PubChem CID | 154661368 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen |
| SMILES | CCC(C)OC(=O)NCCOCCOC.[H][H] |
| InChI | InChI=1S/C10H21NO4.H2/c1-4-9(2)15-10(12)11-5-6-14-8-7-13-3;/h9H,4-8H2,1-3H3,(H,11,12);1H |
| InChIKey | SVQBVDCLDBPNMK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen?
The IUPAC name of butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen (CID 154661368) is butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen.
What is the SMILES notation for butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen?
The canonical SMILES for butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen is CCC(C)OC(=O)NCCOCCOC.[H][H].
What is the InChIKey of butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen?
The InChIKey is SVQBVDCLDBPNMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4.H2/c1-4-9(2)15-10(12)11-5-6-14-8-7-13-3;/h9H,4-8H2,1-3H3,(H,11,12);1H.
What are the key properties of butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen?
butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen has a molecular weight of 221.30 g/mol, XLogP of 1.42, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl N-[2-(2-methoxyethoxy)ethyl]carbamate;molecular hydrogen is sourced from PubChem (CID 154661368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).