C9H18ClNO3 — CID 62726665
3-chloro-N-[2-(2-methoxyethoxy)ethyl]-2-methylpropanamide (PubChem CID 62726665) has the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. Its IUPAC name is 3-chloro-N-[2-(2-methoxyethoxy)ethyl]-2-methylpropanamide.
| Compound Name | 3-chloro-N-[2-(2-methoxyethoxy)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 62726665 |
| Molecular Formula | C9H18ClNO3 |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-chloro-N-[2-(2-methoxyethoxy)ethyl]-2-methylpropanamide |
| SMILES | COCCOCCNC(=O)C(C)CCl |
| InChI | InChI=1S/C9H18ClNO3/c1-8(7-10)9(12)11-3-4-14-6-5-13-2/h8H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | HMXFJZSVUWOQPX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|