About 1-chloroethyl N-(2-methoxyethyl)carbamate
1-chloroethyl N-(2-methoxyethyl)carbamate (PubChem CID 150618578) has the molecular formula C6H12ClNO3
and a molecular weight of 181.62 g/mol. Its IUPAC name is 1-chloroethyl N-(2-methoxyethyl)carbamate.
Molecular Properties
| Compound Name | 1-chloroethyl N-(2-methoxyethyl)carbamate |
| PubChem CID | 150618578 |
| Molecular Formula | C6H12ClNO3 |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 1-chloroethyl N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)OC(C)Cl |
| InChI | InChI=1S/C6H12ClNO3/c1-5(7)11-6(9)8-3-4-10-2/h5H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | IVKJCNTVHIMSFV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethyl N-(2-methoxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethyl N-(2-methoxyethyl)carbamate?
The IUPAC name of 1-chloroethyl N-(2-methoxyethyl)carbamate (CID 150618578) is 1-chloroethyl N-(2-methoxyethyl)carbamate.
What is the SMILES notation for 1-chloroethyl N-(2-methoxyethyl)carbamate?
The canonical SMILES for 1-chloroethyl N-(2-methoxyethyl)carbamate is COCCNC(=O)OC(C)Cl.
What is the InChIKey of 1-chloroethyl N-(2-methoxyethyl)carbamate?
The InChIKey is IVKJCNTVHIMSFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO3/c1-5(7)11-6(9)8-3-4-10-2/h5H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 1-chloroethyl N-(2-methoxyethyl)carbamate?
1-chloroethyl N-(2-methoxyethyl)carbamate has a molecular weight of 181.62 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethyl N-(2-methoxyethyl)carbamate is sourced from PubChem (CID 150618578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).