C5H11NO3 — CID 19987818
2-hydroxy-N-(2-methoxyethyl)acetamide (PubChem CID 19987818) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-hydroxy-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-hydroxy-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 19987818 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 2-hydroxy-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CO |
| InChI | InChI=1S/C5H11NO3/c1-9-3-2-6-5(8)4-7/h7H,2-4H2,1H3,(H,6,8) |
| InChIKey | VJENWUYDMPFSIX-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|