C8H21NO2 — CID 145484894
ethane;N-(2-methoxyethyl)propanamide;molecular hydrogen (PubChem CID 145484894) has the molecular formula C8H21NO2 and a molecular weight of 163.26 g/mol. Its IUPAC name is ethane;N-(2-methoxyethyl)propanamide;molecular hydrogen.
| Compound Name | ethane;N-(2-methoxyethyl)propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 145484894 |
| Molecular Formula | C8H21NO2 |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.16 |
| IUPAC Name | ethane;N-(2-methoxyethyl)propanamide;molecular hydrogen |
| SMILES | CC.CCC(=O)NCCOC.[H][H] |
| InChI | InChI=1S/C6H13NO2.C2H6.H2/c1-3-6(8)7-4-5-9-2;1-2;/h3-5H2,1-2H3,(H,7,8);1-2H3;1H |
| InChIKey | ATDNAEUXHXYYDX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|