About 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate
8-azidooctan-3-yl N-(2-methoxyethyl)carbamate (PubChem CID 166006030) has the molecular formula C12H24N4O3
and a molecular weight of 272.35 g/mol. Its IUPAC name is 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate.
Molecular Properties
| Compound Name | 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate |
| PubChem CID | 166006030 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate |
| SMILES | CCC(CCCCCN=[N+]=[N-])OC(=O)NCCOC |
| InChI | InChI=1S/C12H24N4O3/c1-3-11(7-5-4-6-8-15-16-13)19-12(17)14-9-10-18-2/h11H,3-10H2,1-2H3,(H,14,17) |
| InChIKey | FLWFXRGIDGWYHU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate?
The IUPAC name of 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate (CID 166006030) is 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate.
What is the SMILES notation for 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate?
The canonical SMILES for 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate is CCC(CCCCCN=[N+]=[N-])OC(=O)NCCOC.
What is the InChIKey of 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate?
The InChIKey is FLWFXRGIDGWYHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4O3/c1-3-11(7-5-4-6-8-15-16-13)19-12(17)14-9-10-18-2/h11H,3-10H2,1-2H3,(H,14,17).
What are the key properties of 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate?
8-azidooctan-3-yl N-(2-methoxyethyl)carbamate has a molecular weight of 272.35 g/mol, XLogP of 3.01, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azidooctan-3-yl N-(2-methoxyethyl)carbamate is sourced from PubChem (CID 166006030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).