C14H29N5O4 — CID 171532583
N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-6-azidohexanamide (PubChem CID 171532583) has the molecular formula C14H29N5O4 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-6-azidohexanamide.
| Compound Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-6-azidohexanamide |
|---|---|
| PubChem CID | 171532583 |
| Molecular Formula | C14H29N5O4 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-6-azidohexanamide |
| SMILES | [N-]=[N+]=NCCCCCC(=O)NCCOCCOCCOCCN |
| InChI | InChI=1S/C14H29N5O4/c15-5-8-21-10-12-23-13-11-22-9-7-17-14(20)4-2-1-3-6-18-19-16/h1-13,15H2,(H,17,20) |
| InChIKey | WPBUOKBJRJZZCE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|