C28H54N10O11 — CID 164702946
3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[1,3-bis[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropoxy]propan-2-yl]propanamide (PubChem CID 164702946) has the molecular formula C28H54N10O11 and a molecular weight of 706.80 g/mol. Its IUPAC name is 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[1,3-bis[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropoxy]propan-2-yl]propanamide.
| Compound Name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[1,3-bis[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropoxy]propan-2-yl]propanamide |
|---|---|
| PubChem CID | 164702946 |
| Molecular Formula | C28H54N10O11 |
| Molecular Weight | 706.80 g/mol |
| Exact Mass | 706.40 |
| IUPAC Name | 3-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-N-[1,3-bis[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropoxy]propan-2-yl]propanamide |
| SMILES | [N-]=[N+]=NCCOCCNC(=O)CCOCC(COCCC(=O)NCCOCCN=[N+]=[N-])NC(=O)CCOCCOCCOCCOCCN |
| InChI | InChI=1S/C28H54N10O11/c29-4-12-43-18-20-47-22-21-46-19-17-42-9-3-28(41)36-25(23-48-10-1-26(39)32-5-13-44-15-7-34-37-30)24-49-11-2-27(40)33-6-14-45-16-8-35-38-31/h25H,1-24,29H2,(H,32,39)(H,33,40)(H,36,41) |
| InChIKey | HFAZLMIBUOMUPR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 284.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.80 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|