C34H65N13O12 — CID 170098519
4-amino-N,N'-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-3-oxopropyl]heptanediamide (PubChem CID 170098519) has the molecular formula C34H65N13O12 and a molecular weight of 847.97 g/mol. Its IUPAC name is 4-amino-N,N'-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-3-oxopropyl]heptanediamide.
| Compound Name | 4-amino-N,N'-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-3-oxopropyl]heptanediamide |
|---|---|
| PubChem CID | 170098519 |
| Molecular Formula | C34H65N13O12 |
| Molecular Weight | 847.97 g/mol |
| Exact Mass | 847.49 |
| IUPAC Name | 4-amino-N,N'-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]-3-oxopropyl]heptanediamide |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(=O)CCC(N)(CCC(=O)NCCOCCOCCOCCN=[N+]=[N-])CCC(=O)NCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C34H65N13O12/c35-34(4-1-31(48)39-7-13-51-19-25-57-28-22-54-16-10-42-45-36,5-2-32(49)40-8-14-52-20-26-58-29-23-55-17-11-43-46-37)6-3-33(50)41-9-15-53-21-27-59-30-24-56-18-12-44-47-38/h1-30,35H2,(H,39,48)(H,40,49)(H,41,50) |
| InChIKey | UQRQPTUPTWIMJT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 342.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.97 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|