C14H21N5O7 — CID 58473285
(2,5-dioxopyrrolidin-1-yl) 4-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-4-oxobutanoate (PubChem CID 58473285) has the molecular formula C14H21N5O7 and a molecular weight of 371.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-4-oxobutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 58473285 |
| Molecular Formula | C14H21N5O7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[2-(2-azidoethoxy)ethoxy]ethylamino]-4-oxobutanoate |
| SMILES | [N-]=[N+]=NCCOCCOCCNC(=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H21N5O7/c15-18-17-6-8-25-10-9-24-7-5-16-11(20)1-4-14(23)26-19-12(21)2-3-13(19)22/h1-10H2,(H,16,20) |
| InChIKey | XRVOHRXMKYYZBO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|