C19H30N4O8S2 — CID 159264268
(2,5-dioxopyrrolidin-1-yl) 3-[[6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4-oxohexyl]disulfanyl]propanoate (PubChem CID 159264268) has the molecular formula C19H30N4O8S2 and a molecular weight of 506.60 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[[6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4-oxohexyl]disulfanyl]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[[6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4-oxohexyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 159264268 |
| Molecular Formula | C19H30N4O8S2 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[[6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4-oxohexyl]disulfanyl]propanoate |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCC(=O)CCCSSCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H30N4O8S2/c20-22-21-7-9-29-11-13-30-12-10-28-8-5-16(24)2-1-14-32-33-15-6-19(27)31-23-17(25)3-4-18(23)26/h1-15H2 |
| InChIKey | KWXAXZOJIYYSBP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 157.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|