C27H45N9O12 — CID 176817145
(2,5-dioxopyrrolidin-1-yl) 4-[2-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoyl-[2-[2-(2-azidoethoxy)ethoxy]ethyl]amino]ethylamino]-4-oxobutanoate (PubChem CID 176817145) has the molecular formula C27H45N9O12 and a molecular weight of 687.71 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[2-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoyl-[2-[2-(2-azidoethoxy)ethoxy]ethyl]amino]ethylamino]-4-oxobutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoyl-[2-[2-(2-azidoethoxy)ethoxy]ethyl]amino]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 176817145 |
| Molecular Formula | C27H45N9O12 |
| Molecular Weight | 687.71 g/mol |
| Exact Mass | 687.32 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-[3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]propanoyl-[2-[2-(2-azidoethoxy)ethoxy]ethyl]amino]ethylamino]-4-oxobutanoate |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCC(=O)N(CCNC(=O)CCC(=O)ON1C(=O)CCC1=O)CCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C27H45N9O12/c28-33-31-7-12-43-16-18-45-14-10-35(9-6-30-23(37)1-4-27(41)48-36-25(39)2-3-26(36)40)24(38)5-11-42-15-19-46-21-22-47-20-17-44-13-8-32-34-29/h1-22H2,(H,30,37) |
| InChIKey | WJJHHLBUQIRKBN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 265.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.71 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|