C25H51Cl2N8O9- — CID 163438316
azanide;2-[3-[2-[2-[3-[2-(2-azidoethoxy)ethoxy]propanoyl-[2-[2-[3-(2-chloroethylamino)-3-oxopropoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]propanoylamino]ethylazanium;chloride (PubChem CID 163438316) has the molecular formula C25H51Cl2N8O9- and a molecular weight of 678.64 g/mol. Its IUPAC name is azanide;2-[3-[2-[2-[3-[2-(2-azidoethoxy)ethoxy]propanoyl-[2-[2-[3-(2-chloroethylamino)-3-oxopropoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]propanoylamino]ethylazanium;chloride.
| Compound Name | azanide;2-[3-[2-[2-[3-[2-(2-azidoethoxy)ethoxy]propanoyl-[2-[2-[3-(2-chloroethylamino)-3-oxopropoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]propanoylamino]ethylazanium;chloride |
|---|---|
| PubChem CID | 163438316 |
| Molecular Formula | C25H51Cl2N8O9- |
| Molecular Weight | 678.64 g/mol |
| Exact Mass | 677.32 |
| IUPAC Name | azanide;2-[3-[2-[2-[3-[2-(2-azidoethoxy)ethoxy]propanoyl-[2-[2-[3-(2-chloroethylamino)-3-oxopropoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]propanoylamino]ethylazanium;chloride |
| SMILES | [Cl-].[N-]=[N+]=NCCOCCOCCC(=O)N(CCOCCOCCC(=O)NCC[NH3+])CCOCCOCCC(=O)NCCCl.[NH2-] |
| InChI | InChI=1S/C25H48ClN7O9.ClH.H2N/c26-4-6-29-23(34)1-11-37-18-21-41-15-9-33(25(36)3-13-39-17-20-40-14-8-31-32-28)10-16-42-22-19-38-12-2-24(35)30-7-5-27;;/h1-22,27H2,(H,29,34)(H,30,35);1H;1H2/q;;-1 |
| InChIKey | KONJAYGYUWHIKH-UHFFFAOYSA-N |
| XLogP | -3.17 |
| TPSA | 243.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.64 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|