C32H49N9O11 — CID 176817160
4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethyl-[3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]amino]ethylamino]-4-oxobutanoic acid (PubChem CID 176817160) has the molecular formula C32H49N9O11 and a molecular weight of 735.80 g/mol. Its IUPAC name is 4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethyl-[3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]amino]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethyl-[3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]amino]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 176817160 |
| Molecular Formula | C32H49N9O11 |
| Molecular Weight | 735.80 g/mol |
| Exact Mass | 735.36 |
| IUPAC Name | 4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethyl-[3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]amino]ethylamino]-4-oxobutanoic acid |
| SMILES | Cc1nnc(-c2ccc(OCCOCCOCCOCCOCCC(=O)N(CCNC(=O)CCC(=O)O)CCOCCOCCN=[N+]=[N-])cc2)nn1 |
| InChI | InChI=1S/C32H49N9O11/c1-26-36-38-32(39-37-26)27-2-4-28(5-3-27)52-25-24-51-23-22-50-21-20-49-19-16-46-13-8-30(43)41(11-9-34-29(42)6-7-31(44)45)12-15-48-18-17-47-14-10-35-40-33/h2-5H,6-25H2,1H3,(H,34,42)(H,44,45) |
| InChIKey | MNGHGMVYEJZQRV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 251.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.80 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|