C27H39N7O14 — CID 59169176
(2,5-dioxopyrrolidin-1-yl) 3-[3-[2-[2-[2-[2-[(2-azidoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]amino]propanoate (PubChem CID 59169176) has the molecular formula C27H39N7O14 and a molecular weight of 685.64 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[3-[2-[2-[2-[2-[(2-azidoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]amino]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[2-[2-[2-[2-[(2-azidoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]amino]propanoate |
|---|---|
| PubChem CID | 59169176 |
| Molecular Formula | C27H39N7O14 |
| Molecular Weight | 685.64 g/mol |
| Exact Mass | 685.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-[2-[2-[2-[2-[(2-azidoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]amino]propanoate |
| SMILES | [N-]=[N+]=NCC(=O)NCCOCCOCCOCCOCCC(=O)N(CCC(=O)ON1C(=O)CCC1=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C27H39N7O14/c28-31-30-19-20(35)29-8-12-44-14-16-46-18-17-45-15-13-43-11-7-21(36)32(9-5-26(41)47-33-22(37)1-2-23(33)38)10-6-27(42)48-34-24(39)3-4-25(34)40/h1-19H2,(H,29,35) |
| InChIKey | ROMDYXUQVDWYPB-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 262.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.64 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|