C15H29N5O5S2 — CID 118362426
3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-N-[2-[[3-(methylamino)-3-oxopropyl]disulfanyl]ethyl]propanamide (PubChem CID 118362426) has the molecular formula C15H29N5O5S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-N-[2-[[3-(methylamino)-3-oxopropyl]disulfanyl]ethyl]propanamide.
| Compound Name | 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-N-[2-[[3-(methylamino)-3-oxopropyl]disulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 118362426 |
| Molecular Formula | C15H29N5O5S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-N-[2-[[3-(methylamino)-3-oxopropyl]disulfanyl]ethyl]propanamide |
| SMILES | CNC(=O)CCSSCCNC(=O)CCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C15H29N5O5S2/c1-17-14(21)3-12-26-27-13-5-18-15(22)2-6-23-8-10-25-11-9-24-7-4-19-20-16/h2-13H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | BRHGUXYGQJVYRN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|