C16H32N4O5 — CID 168855341
3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-(2,2-dimethylpropyl)propanamide (PubChem CID 168855341) has the molecular formula C16H32N4O5 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-(2,2-dimethylpropyl)propanamide.
| Compound Name | 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-(2,2-dimethylpropyl)propanamide |
|---|---|
| PubChem CID | 168855341 |
| Molecular Formula | C16H32N4O5 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-N-(2,2-dimethylpropyl)propanamide |
| SMILES | CC(C)(C)CNC(=O)CCOCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C16H32N4O5/c1-16(2,3)14-18-15(21)4-6-22-8-10-24-12-13-25-11-9-23-7-5-19-20-17/h4-14H2,1-3H3,(H,18,21) |
| InChIKey | PEXSNEOPEQYSIB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|