C21H43NO6 — CID 168855323
3-[2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]-N-(2,2-dimethylpropyl)propanamide (PubChem CID 168855323) has the molecular formula C21H43NO6 and a molecular weight of 405.58 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]-N-(2,2-dimethylpropyl)propanamide.
| Compound Name | 3-[2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]-N-(2,2-dimethylpropyl)propanamide |
|---|---|
| PubChem CID | 168855323 |
| Molecular Formula | C21H43NO6 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | 3-[2-[2-[2-[2-(2,2-dimethylpropoxy)ethoxy]ethoxy]ethoxy]ethoxy]-N-(2,2-dimethylpropyl)propanamide |
| SMILES | CC(C)(C)CNC(=O)CCOCCOCCOCCOCCOCC(C)(C)C |
| InChI | InChI=1S/C21H43NO6/c1-20(2,3)17-22-19(23)7-8-24-9-10-25-11-12-26-13-14-27-15-16-28-18-21(4,5)6/h7-18H2,1-6H3,(H,22,23) |
| InChIKey | YMAKRTTXYGIVII-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|