C34H66N2O4 — CID 159724383
6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylhex-4-enamide;6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)hex-4-enamide (PubChem CID 159724383) has the molecular formula C34H66N2O4 and a molecular weight of 566.91 g/mol. Its IUPAC name is 6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylhex-4-enamide;6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)hex-4-enamide.
| Compound Name | 6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylhex-4-enamide;6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)hex-4-enamide |
|---|---|
| PubChem CID | 159724383 |
| Molecular Formula | C34H66N2O4 |
| Molecular Weight | 566.91 g/mol |
| Exact Mass | 566.50 |
| IUPAC Name | 6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylhex-4-enamide;6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)hex-4-enamide |
| SMILES | CC(C)(C)CNC(=O)C(C)(C)CC=CCOCC(C)(C)C.CC(C)(C)CNC(=O)CCC=CCOCC(C)(C)C |
| InChI | InChI=1S/C18H35NO2.C16H31NO2/c1-16(2,3)13-19-15(20)18(7,8)11-9-10-12-21-14-17(4,5)6;1-15(2,3)12-17-14(18)10-8-7-9-11-19-13-16(4,5)6/h9-10H,11-14H2,1-8H3,(H,19,20);7,9H,8,10-13H2,1-6H3,(H,17,18) |
| InChIKey | NALGLQPDMGEBOC-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.91 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|