C11H21N3O5 — CID 166997753
N-(2,2-dimethylpropyl)-2-[[2-[(2-hydroperoxyacetyl)amino]acetyl]amino]acetamide (PubChem CID 166997753) has the molecular formula C11H21N3O5 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-2-[[2-[(2-hydroperoxyacetyl)amino]acetyl]amino]acetamide.
| Compound Name | N-(2,2-dimethylpropyl)-2-[[2-[(2-hydroperoxyacetyl)amino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 166997753 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-(2,2-dimethylpropyl)-2-[[2-[(2-hydroperoxyacetyl)amino]acetyl]amino]acetamide |
| SMILES | CC(C)(C)CNC(=O)CNC(=O)CNC(=O)COO |
| InChI | InChI=1S/C11H21N3O5/c1-11(2,3)7-14-9(16)5-12-8(15)4-13-10(17)6-19-18/h18H,4-7H2,1-3H3,(H,12,15)(H,13,17)(H,14,16) |
| InChIKey | KMVWHIKXMNTCGT-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|