C11H24NO4P — CID 21027139
2-diethoxyphosphoryl-N-(2,2-dimethylpropyl)acetamide (PubChem CID 21027139) has the molecular formula C11H24NO4P and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N-(2,2-dimethylpropyl)acetamide.
| Compound Name | 2-diethoxyphosphoryl-N-(2,2-dimethylpropyl)acetamide |
|---|---|
| PubChem CID | 21027139 |
| Molecular Formula | C11H24NO4P |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2-diethoxyphosphoryl-N-(2,2-dimethylpropyl)acetamide |
| SMILES | CCOP(=O)(CC(=O)NCC(C)(C)C)OCC |
| InChI | InChI=1S/C11H24NO4P/c1-6-15-17(14,16-7-2)8-10(13)12-9-11(3,4)5/h6-9H2,1-5H3,(H,12,13) |
| InChIKey | UKKOLDAZNXQFCT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|