C10H22NO4P — CID 13124144
2-diethoxyphosphoryl-N,N-diethylacetamide (PubChem CID 13124144) has the molecular formula C10H22NO4P and a molecular weight of 251.26 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N,N-diethylacetamide.
| Compound Name | 2-diethoxyphosphoryl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 13124144 |
| Molecular Formula | C10H22NO4P |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-diethoxyphosphoryl-N,N-diethylacetamide |
| SMILES | CCOP(=O)(CC(=O)N(CC)CC)OCC |
| InChI | InChI=1S/C10H22NO4P/c1-5-11(6-2)10(12)9-16(13,14-7-3)15-8-4/h5-9H2,1-4H3 |
| InChIKey | WBLDKEWTTNXBRQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|