C12H24NO5P — CID 86592927
2-diethoxyphosphoryl-N-(4-hydroxycyclohexyl)acetamide (PubChem CID 86592927) has the molecular formula C12H24NO5P and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N-(4-hydroxycyclohexyl)acetamide.
| Compound Name | 2-diethoxyphosphoryl-N-(4-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 86592927 |
| Molecular Formula | C12H24NO5P |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-diethoxyphosphoryl-N-(4-hydroxycyclohexyl)acetamide |
| SMILES | CCOP(=O)(CC(=O)NC1CCC(O)CC1)OCC |
| InChI | InChI=1S/C12H24NO5P/c1-3-17-19(16,18-4-2)9-12(15)13-10-5-7-11(14)8-6-10/h10-11,14H,3-9H2,1-2H3,(H,13,15) |
| InChIKey | VOLAXYRKYKMRHN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|