C17H34N2O8P2 — CID 71511611
2-diethoxyphosphoryl-N-[(1S,3R)-3-[(2-diethoxyphosphorylacetyl)amino]cyclopentyl]acetamide (PubChem CID 71511611) has the molecular formula C17H34N2O8P2 and a molecular weight of 456.41 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N-[(1S,3R)-3-[(2-diethoxyphosphorylacetyl)amino]cyclopentyl]acetamide.
| Compound Name | 2-diethoxyphosphoryl-N-[(1S,3R)-3-[(2-diethoxyphosphorylacetyl)amino]cyclopentyl]acetamide |
|---|---|
| PubChem CID | 71511611 |
| Molecular Formula | C17H34N2O8P2 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-diethoxyphosphoryl-N-[(1S,3R)-3-[(2-diethoxyphosphorylacetyl)amino]cyclopentyl]acetamide |
| SMILES | CCOP(=O)(CC(=O)N[C@@H]1CC[C@H](NC(=O)CP(=O)(OCC)OCC)C1)OCC |
| InChI | InChI=1S/C17H34N2O8P2/c1-5-24-28(22,25-6-2)12-16(20)18-14-9-10-15(11-14)19-17(21)13-29(23,26-7-3)27-8-4/h14-15H,5-13H2,1-4H3,(H,18,20)(H,19,21)/t14-,15+ |
| InChIKey | OUGPIHUMVIQMBZ-GASCZTMLSA-N |
| XLogP | 2.67 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|