C33H68N3O15P3 — CID 101424883
N-[3-[2,2-bis[3-[(2-diethoxyphosphorylacetyl)amino]propoxymethyl]butoxy]propyl]-2-diethoxyphosphorylacetamide (PubChem CID 101424883) has the molecular formula C33H68N3O15P3 and a molecular weight of 839.83 g/mol. Its IUPAC name is N-[3-[2,2-bis[3-[(2-diethoxyphosphorylacetyl)amino]propoxymethyl]butoxy]propyl]-2-diethoxyphosphorylacetamide.
| Compound Name | N-[3-[2,2-bis[3-[(2-diethoxyphosphorylacetyl)amino]propoxymethyl]butoxy]propyl]-2-diethoxyphosphorylacetamide |
|---|---|
| PubChem CID | 101424883 |
| Molecular Formula | C33H68N3O15P3 |
| Molecular Weight | 839.83 g/mol |
| Exact Mass | 839.39 |
| IUPAC Name | N-[3-[2,2-bis[3-[(2-diethoxyphosphorylacetyl)amino]propoxymethyl]butoxy]propyl]-2-diethoxyphosphorylacetamide |
| SMILES | CCOP(=O)(CC(=O)NCCCOCC(CC)(COCCCNC(=O)CP(=O)(OCC)OCC)COCCCNC(=O)CP(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C33H68N3O15P3/c1-8-33(27-43-21-15-18-34-30(37)24-52(40,46-9-2)47-10-3,28-44-22-16-19-35-31(38)25-53(41,48-11-4)49-12-5)29-45-23-17-20-36-32(39)26-54(42,50-13-6)51-14-7/h8-29H2,1-7H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | SLLLNDKZYPFNIC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 221.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.83 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|