C37H73N3O11 — CID 118124360
N-[2-[2-[2,2-bis[2-[2-(6-hydroxyhexanoylamino)ethoxy]ethoxymethyl]butoxy]ethoxy]ethyl]heptanamide (PubChem CID 118124360) has the molecular formula C37H73N3O11 and a molecular weight of 736.00 g/mol. Its IUPAC name is N-[2-[2-[2,2-bis[2-[2-(6-hydroxyhexanoylamino)ethoxy]ethoxymethyl]butoxy]ethoxy]ethyl]heptanamide.
| Compound Name | N-[2-[2-[2,2-bis[2-[2-(6-hydroxyhexanoylamino)ethoxy]ethoxymethyl]butoxy]ethoxy]ethyl]heptanamide |
|---|---|
| PubChem CID | 118124360 |
| Molecular Formula | C37H73N3O11 |
| Molecular Weight | 736.00 g/mol |
| Exact Mass | 735.52 |
| IUPAC Name | N-[2-[2-[2,2-bis[2-[2-(6-hydroxyhexanoylamino)ethoxy]ethoxymethyl]butoxy]ethoxy]ethyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCOCCOCC(CC)(COCCOCCNC(=O)CCCCCO)COCCOCCNC(=O)CCCCCO |
| InChI | InChI=1S/C37H73N3O11/c1-3-5-6-9-14-34(43)38-17-22-46-25-28-49-31-37(4-2,32-50-29-26-47-23-18-39-35(44)15-10-7-12-20-41)33-51-30-27-48-24-19-40-36(45)16-11-8-13-21-42/h41-42H,3-33H2,1-2H3,(H,38,43)(H,39,44)(H,40,45) |
| InChIKey | ICDDWUZOWSMPEB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 183.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.00 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|