C33H71N3O18Si3 — CID 168787203
2-[2,2-bis[2-(3-trimethoxysilylpropylcarbamoyloxy)ethoxymethyl]butoxy]ethyl N-(3-trimethoxysilylpropyl)carbamate (PubChem CID 168787203) has the molecular formula C33H71N3O18Si3 and a molecular weight of 882.19 g/mol. Its IUPAC name is 2-[2,2-bis[2-(3-trimethoxysilylpropylcarbamoyloxy)ethoxymethyl]butoxy]ethyl N-(3-trimethoxysilylpropyl)carbamate.
| Compound Name | 2-[2,2-bis[2-(3-trimethoxysilylpropylcarbamoyloxy)ethoxymethyl]butoxy]ethyl N-(3-trimethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 168787203 |
| Molecular Formula | C33H71N3O18Si3 |
| Molecular Weight | 882.19 g/mol |
| Exact Mass | 881.40 |
| IUPAC Name | 2-[2,2-bis[2-(3-trimethoxysilylpropylcarbamoyloxy)ethoxymethyl]butoxy]ethyl N-(3-trimethoxysilylpropyl)carbamate |
| SMILES | CCC(COCCOC(=O)NCCC[Si](OC)(OC)OC)(COCCOC(=O)NCCC[Si](OC)(OC)OC)COCCOC(=O)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C33H71N3O18Si3/c1-11-33(27-49-18-21-52-30(37)34-15-12-24-55(40-2,41-3)42-4,28-50-19-22-53-31(38)35-16-13-25-56(43-5,44-6)45-7)29-51-20-23-54-32(39)36-17-14-26-57(46-8,47-9)48-10/h11-29H2,1-10H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | XJWFOEDEHZLDNJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 225.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|