C30H60N6O18Si3 — CID 59824458
2-[2,4,6-trioxo-3,5-bis[2-(3-trimethoxysilylpropylcarbamoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl N-(3-trimethoxysilylpropyl)carbamate (PubChem CID 59824458) has the molecular formula C30H60N6O18Si3 and a molecular weight of 877.09 g/mol. Its IUPAC name is 2-[2,4,6-trioxo-3,5-bis[2-(3-trimethoxysilylpropylcarbamoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl N-(3-trimethoxysilylpropyl)carbamate.
| Compound Name | 2-[2,4,6-trioxo-3,5-bis[2-(3-trimethoxysilylpropylcarbamoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl N-(3-trimethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 59824458 |
| Molecular Formula | C30H60N6O18Si3 |
| Molecular Weight | 877.09 g/mol |
| Exact Mass | 876.33 |
| IUPAC Name | 2-[2,4,6-trioxo-3,5-bis[2-(3-trimethoxysilylpropylcarbamoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethyl N-(3-trimethoxysilylpropyl)carbamate |
| SMILES | CO[Si](CCCNC(=O)OCCn1c(=O)n(CCOC(=O)NCCC[Si](OC)(OC)OC)c(=O)n(CCOC(=O)NCCC[Si](OC)(OC)OC)c1=O)(OC)OC |
| InChI | InChI=1S/C30H60N6O18Si3/c1-43-55(44-2,45-3)22-10-13-31-25(37)52-19-16-34-28(40)35(17-20-53-26(38)32-14-11-23-56(46-4,47-5)48-6)30(42)36(29(34)41)18-21-54-27(39)33-15-12-24-57(49-7,50-8)51-9/h10-24H2,1-9H3,(H,31,37)(H,32,38)(H,33,39) |
| InChIKey | CNZMZYBVSSYYFO-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 264.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.09 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|