C27H36N6O15 — CID 58984201
2-[2-[2,4,6-trioxo-3,5-bis[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 58984201) has the molecular formula C27H36N6O15 and a molecular weight of 684.61 g/mol. Its IUPAC name is 2-[2-[2,4,6-trioxo-3,5-bis[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2,4,6-trioxo-3,5-bis[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 58984201 |
| Molecular Formula | C27H36N6O15 |
| Molecular Weight | 684.61 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | 2-[2-[2,4,6-trioxo-3,5-bis[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl]-1,3,5-triazinan-1-yl]ethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCn1c(=O)n(CCOC(=O)NCCOC(=O)C=C)c(=O)n(CCOC(=O)NCCOC(=O)C=C)c1=O |
| InChI | InChI=1S/C27H36N6O15/c1-4-19(34)43-13-7-28-22(37)46-16-10-31-25(40)32(11-17-47-23(38)29-8-14-44-20(35)5-2)27(42)33(26(31)41)12-18-48-24(39)30-9-15-45-21(36)6-3/h4-6H,1-3,7-18H2,(H,28,37)(H,29,38)(H,30,39) |
| InChIKey | UPMPOFHNHLNPKE-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 259.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.61 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|