C31H52N6O9 — CID 20801392
2-[6-[3,5-bis(6-acetamidohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]ethyl prop-2-enoate (PubChem CID 20801392) has the molecular formula C31H52N6O9 and a molecular weight of 652.79 g/mol. Its IUPAC name is 2-[6-[3,5-bis(6-acetamidohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[6-[3,5-bis(6-acetamidohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 20801392 |
| Molecular Formula | C31H52N6O9 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.38 |
| IUPAC Name | 2-[6-[3,5-bis(6-acetamidohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)NCCCCCCn1c(=O)n(CCCCCCNC(C)=O)c(=O)n(CCCCCCNC(C)=O)c1=O |
| InChI | InChI=1S/C31H52N6O9/c1-4-27(40)45-23-24-46-28(41)34-19-13-7-10-16-22-37-30(43)35(20-14-8-5-11-17-32-25(2)38)29(42)36(31(37)44)21-15-9-6-12-18-33-26(3)39/h4H,1,5-24H2,2-3H3,(H,32,38)(H,33,39)(H,34,41) |
| InChIKey | WWHGPQPUMUJKDI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 188.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|