C39H60N6O15 — CID 23541097
2-[6-[[4,6-dioxo-3,5-bis[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-oxadiazinan-2-ylidene]amino]hexylcarbamoyloxy]ethyl prop-2-enoate (PubChem CID 23541097) has the molecular formula C39H60N6O15 and a molecular weight of 852.94 g/mol. Its IUPAC name is 2-[6-[[4,6-dioxo-3,5-bis[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-oxadiazinan-2-ylidene]amino]hexylcarbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[6-[[4,6-dioxo-3,5-bis[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-oxadiazinan-2-ylidene]amino]hexylcarbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 23541097 |
| Molecular Formula | C39H60N6O15 |
| Molecular Weight | 852.94 g/mol |
| Exact Mass | 852.41 |
| IUPAC Name | 2-[6-[[4,6-dioxo-3,5-bis[6-(2-prop-2-enoyloxyethoxycarbonylamino)hexyl]-1,3,5-oxadiazinan-2-ylidene]amino]hexylcarbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)NCCCCCC/N=c1\oc(=O)n(CCCCCCNC(=O)OCCOC(=O)C=C)c(=O)n1CCCCCCNC(=O)OCCOC(=O)C=C |
| InChI | InChI=1S/C39H60N6O15/c1-4-31(46)54-25-28-57-35(49)41-20-14-8-7-13-19-40-34-44(23-17-11-9-15-21-42-36(50)58-29-26-55-32(47)5-2)38(52)45(39(53)60-34)24-18-12-10-16-22-43-37(51)59-30-27-56-33(48)6-3/h4-6H,1-3,7-30H2,(H,41,49)(H,42,50)(H,43,51)/b40-34- |
| InChIKey | HUAHQOVONADYOA-UQQUJRAVSA-N |
| XLogP | 2.55 |
| TPSA | 263.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.94 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|