C15H22N2O8 — CID 87915817
2-[3-(2-prop-2-enoyloxyethoxycarbonylamino)propylcarbamoyloxy]ethyl prop-2-enoate (PubChem CID 87915817) has the molecular formula C15H22N2O8 and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-[3-(2-prop-2-enoyloxyethoxycarbonylamino)propylcarbamoyloxy]ethyl prop-2-enoate.
| Compound Name | 2-[3-(2-prop-2-enoyloxyethoxycarbonylamino)propylcarbamoyloxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 87915817 |
| Molecular Formula | C15H22N2O8 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[3-(2-prop-2-enoyloxyethoxycarbonylamino)propylcarbamoyloxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)NCCCNC(=O)OCCOC(=O)C=C |
| InChI | InChI=1S/C15H22N2O8/c1-3-12(18)22-8-10-24-14(20)16-6-5-7-17-15(21)25-11-9-23-13(19)4-2/h3-4H,1-2,5-11H2,(H,16,20)(H,17,21) |
| InChIKey | NXYXFUIDQHUEKS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|