C20H32N2O8 — CID 58975893
3-[6-(3-prop-2-enoyloxypropoxycarbonylamino)hexylcarbamoyloxy]propyl prop-2-enoate (PubChem CID 58975893) has the molecular formula C20H32N2O8 and a molecular weight of 428.48 g/mol. Its IUPAC name is 3-[6-(3-prop-2-enoyloxypropoxycarbonylamino)hexylcarbamoyloxy]propyl prop-2-enoate.
| Compound Name | 3-[6-(3-prop-2-enoyloxypropoxycarbonylamino)hexylcarbamoyloxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 58975893 |
| Molecular Formula | C20H32N2O8 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 3-[6-(3-prop-2-enoyloxypropoxycarbonylamino)hexylcarbamoyloxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOC(=O)NCCCCCCNC(=O)OCCCOC(=O)C=C |
| InChI | InChI=1S/C20H32N2O8/c1-3-17(23)27-13-9-15-29-19(25)21-11-7-5-6-8-12-22-20(26)30-16-10-14-28-18(24)4-2/h3-4H,1-2,5-16H2,(H,21,25)(H,22,26) |
| InChIKey | VXYPRTRCJZUJSY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|