C21H40N2O12Si — CID 162702779
2-[2-[2-[2-[2-(3-trimethoxysilylpropylcarbamoyloxy)ethoxy]ethoxy]ethoxy]ethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 162702779) has the molecular formula C21H40N2O12Si and a molecular weight of 540.64 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(3-trimethoxysilylpropylcarbamoyloxy)ethoxy]ethoxy]ethoxy]ethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2-[2-[2-(3-trimethoxysilylpropylcarbamoyloxy)ethoxy]ethoxy]ethoxy]ethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 162702779 |
| Molecular Formula | C21H40N2O12Si |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2-[2-[2-[2-[2-(3-trimethoxysilylpropylcarbamoyloxy)ethoxy]ethoxy]ethoxy]ethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCOCCOCCOCCOC(=O)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C21H40N2O12Si/c1-5-19(24)33-9-8-23-21(26)35-17-15-32-13-11-30-10-12-31-14-16-34-20(25)22-7-6-18-36(27-2,28-3)29-4/h5H,1,6-18H2,2-4H3,(H,22,25)(H,23,26) |
| InChIKey | WCZSOAZLJGNHQT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|