C14H23NO6 — CID 167317155
2-(3-prop-2-enoyloxypropylcarbamoyloxy)ethyl 2-methylbutanoate (PubChem CID 167317155) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-(3-prop-2-enoyloxypropylcarbamoyloxy)ethyl 2-methylbutanoate.
| Compound Name | 2-(3-prop-2-enoyloxypropylcarbamoyloxy)ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 167317155 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-(3-prop-2-enoyloxypropylcarbamoyloxy)ethyl 2-methylbutanoate |
| SMILES | C=CC(=O)OCCCNC(=O)OCCOC(=O)C(C)CC |
| InChI | InChI=1S/C14H23NO6/c1-4-11(3)13(17)20-9-10-21-14(18)15-7-6-8-19-12(16)5-2/h5,11H,2,4,6-10H2,1,3H3,(H,15,18) |
| InChIKey | FSYGFWPLKQRRAD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|